A series of tetranuclear grid-type complexes were prepared by the reaction of the asymmetric multidentate ligand HL (HL = 2-[3-(2-hydroxyphenyl)-1H-pyrazol-5-yl]-6-pyridine carboxylic acid ethylester) with different metal sources. The tetranuclear copper complex, [Cu4(L1)4(NO3)4(H2O)4] Et2O 2MeOH (1, HL1 = 2-[3-(2-hydroxyphenyl)-1H-pyrazol-5-yl]-6-pyridine carboxylic acid methyl ester) consists...

Multidentate tripodal ligands, N(CH2-m-C6H4-CH2tacn)3 (L1) and N(CH2-o-C6H4-CH2N(CH2py)2)3 (L2), have been devised for assembling high-nuclearity metal clusters. By using the same tripodal platform with different ligand appendages, either triazacyclononanes or dipicolylamines, and functionalizing either the ortho or the meta positions on the tris(xylyl) linker arms, discrete trimetal phosphate ...

Relatively little is known about structural transformations of very small metal clusters that result from the adsorption of molecules. Here, the ligand-induced structural transformation of Ag(5)(+)(g) by 1,4-cyclohexadiene, which is capable of binding metal clusters as a bidentate ligand, is investigated using equilibrium mass spectrometry experiments and theory. Based on the measured sequentia...

A series of symmetric multidentate Schiff base ligands 1–13 based on the N‚N′-4‚4′-ethylenebiphenylbis-3-methoxysalicylideneimine for used to bind various transition metals detection of K, AgI‚ CuII, Sr II Co II and NiII at trace levels in real-world samples has been synthesized purified and their structures was characterized.

A new and very efficient one-pot synthesis, in water, of 6 pi + 6 pi electron zwitterionic benzoquinonemonoimines involves the first examples of transamination reactions in quinonoid chemistry and allows the introduction of functionalities to, and the fine-tuning of the properties of, a large family of molecules with interesting potential, both in supramolecular chemistry and as multidentate li...